CAS 1426958-51-1 is the registry number for Methyl 4-amino-3-(phenylamino)benzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Methyl 4-amino-3-anilinobenzoate (CAS 1426958-51-1) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 4-amino-3-anilinobenzoate. InChIKey: VEJJHWGOUQIAEN-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 4-amino-3-anilinobenzoate |
| InChIKey | VEJJHWGOUQIAEN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)