cas: 539-17-3 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4,4'-azodianiline (CAS 539-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018607-250MG |
| cas | 539-17-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 2g | 966.34 Pln |
| delivery time | 2-3 weeks |
|---|
4-[[4-(dimethylamino)phenyl]diazenyl]aniline (CAS 539-17-3) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]aniline. InChIKey: BVRIUXYMUSKBHG-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]aniline |
| InChIKey | BVRIUXYMUSKBHG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)