cas: 14417-01-7 — see every product listed under this CAS number, including other names
N,N-Dimethylbenzenesulfonamide 97+% (CAS 14417-01-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A626655-100g |
| cas | 14417-01-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3741.25 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 1037.88 Pln |
| purity | 97+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A626655 |
N,N-dimethylbenzenesulfonamide (CAS 14417-01-7) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: N,N-dimethylbenzenesulfonamide. InChIKey: BVSPJPNNLDIUFE-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | N,N-dimethylbenzenesulfonamide |
| InChIKey | BVSPJPNNLDIUFE-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)