cas: 99169-99-0 — see every product listed under this CAS number, including other names
N,N-Dimethylindoline-5-sulfonamide (CAS 99169-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023732-1G |
| cas | 99169-99-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1736.91 Pln |
| delivery time | 2-3 weeks |
|---|
N,N-dimethyl-2,3-dihydro-1H-indole-5-sulfonamide (CAS 99169-99-0) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: N,N-dimethyl-2,3-dihydro-1H-indole-5-sulfonamide. InChIKey: RTBHIQIVIFMZDZ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | N,N-dimethyl-2,3-dihydro-1H-indole-5-sulfonamide |
| InChIKey | RTBHIQIVIFMZDZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)