cas: 23530-43-0 — see every product listed under this CAS number, including other names
N,N-dimethyl-2-nitrobenzenesulfonamide, 98%, 98% (CAS 23530-43-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NLI-1g |
| cas | 23530-43-0 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 10g | 520.40 Pln | |
| Chemat | 25g | 981.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-2-nitrobenzenesulfonamide (CAS 23530-43-0) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: N,N-dimethyl-2-nitrobenzenesulfonamide. InChIKey: URZRWUKJMJVQBP-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | N,N-dimethyl-2-nitrobenzenesulfonamide |
| InChIKey | URZRWUKJMJVQBP-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)