Products 1154379-40-4
CAS 1154379-40-4 appears in our catalog under these names: 5-Amino-2-methanesulfonamidobenzoic acid, 95%, 5-Amino-2-methanesulfonamidobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-amino-2-(methanesulfonamido)benzoic acid (CAS 1154379-40-4) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: 5-amino-2-(methanesulfonamido)benzoic acid. InChIKey: ZFQSDJZMNGJQNO-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 5-amino-2-(methanesulfonamido)benzoic acid |
| InChIKey | ZFQSDJZMNGJQNO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)