CAS 80259-08-1 appears in our catalog under these names: N-(4-Methyl-3-nitrophenyl)methanesulfonamide, 95%, N-(4-Methyl-3-nitrophenyl)methanesulfonamide, 95+%, N–(4–Methyl–3–nitrophenyl)methanesulfonamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
N-(4-methyl-3-nitrophenyl)methanesulfonamide (CAS 80259-08-1) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: N-(4-methyl-3-nitrophenyl)methanesulfonamide. InChIKey: WZFHLQAYSGSNKO-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | N-(4-methyl-3-nitrophenyl)methanesulfonamide |
| InChIKey | WZFHLQAYSGSNKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)