CAS 96-78-6 appears in our catalog under these names: 4-Aminoacetanilide-3-sulfonic acid, 95%, 4-Aminoacetanilide-3-sulfonic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g, 50g.
5-acetamido-2-aminobenzenesulfonic acid (CAS 96-78-6) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: 5-acetamido-2-aminobenzenesulfonic acid. InChIKey: PHRVJZNHPVJYOM-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 5-acetamido-2-aminobenzenesulfonic acid |
| InChIKey | PHRVJZNHPVJYOM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)N)S(=O)(=O)O |
Computed by PubChem (NCBI)