CAS 15690-38-7 appears in our catalog under these names: Deacetyl-7-aminocephalosporanic acid, 7-Amino-deacetylcephalosporanic Acid, >95% (HPLC), 7-Aminodeacetylcephalosporanic Acid, >97.0%(HPLC)(T), (6R,7R)-7-Amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 97%, Cefmenoxime Impurity 4. Offered by: TargetMol, TRC, TCI, Combi-blocks, Chemat Brand. Available pack sizes: 5mg, 2,5g, 250mg, 5g, 25g, 1g, 100g, 10g.
(6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 15690-38-7) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: BQIMPGFMMOZASS-CLZZGJSISA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | BQIMPGFMMOZASS-CLZZGJSISA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)CO |
Computed by PubChem (NCBI)