cas: 17459-03-9 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-nitrobenzenesulfonamide, 98%, 98% (CAS 17459-03-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AO9X-250mg |
| cas | 17459-03-9 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 765.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-nitrobenzenesulfonamide (CAS 17459-03-9) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: N,N-dimethyl-4-nitrobenzenesulfonamide. InChIKey: ZCWXRMBVAKOURU-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | N,N-dimethyl-4-nitrobenzenesulfonamide |
| InChIKey | ZCWXRMBVAKOURU-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)