cas: 174291-96-4 — see every product listed under this CAS number, including other names
N-((1R,2R)-2-Aminocyclohexyl)-4-methylbenzenesulfonamide 97% (CAS 174291-96-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A829971-1g |
| cas | 174291-96-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 25g | 882.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A829971 |
N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide (CAS 174291-96-4) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide. InChIKey: VVOFSHARRCJLLA-CHWSQXEVSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | VVOFSHARRCJLLA-CHWSQXEVSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H]2CCCC[C@H]2N |
Computed by PubChem (NCBI)