cas: 174291-96-4 — see every product listed under this CAS number, including other names
N-((1R,2R)-2-Aminocyclohexyl)-4-methylbenzenesulfonamide, 97% (CAS 174291-96-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547081-250MG |
| cas | 174291-96-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 513.38 Pln | |
| Fluorochem | 25g | 1013.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide (CAS 174291-96-4) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide. InChIKey: VVOFSHARRCJLLA-CHWSQXEVSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | VVOFSHARRCJLLA-CHWSQXEVSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H]2CCCC[C@H]2N |
Computed by PubChem (NCBI)