cas: 174291-97-5 — see every product listed under this CAS number, including other names
N-((1S,2S)-2-Aminocyclohexyl)-4-methylbenzenesulfonamide 98% (CAS 174291-97-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A566708-250mg |
| cas | 174291-97-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 25g | 1338.25 Pln | |
| Ambeed | 100g | 4130.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A566708 |
N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide (CAS 174291-97-5) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide. InChIKey: VVOFSHARRCJLLA-STQMWFEESA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | VVOFSHARRCJLLA-STQMWFEESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H]2CCCC[C@@H]2N |
Computed by PubChem (NCBI)