cas: 365-29-7 — see every product listed under this CAS number, including other names
N-(2,3,4-Trifluorophenyl)acetamide 96% (CAS 365-29-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A844755-250mg |
| cas | 365-29-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 25g | 1032.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A844755 |
N-(2,3,4-trifluorophenyl)acetamide (CAS 365-29-7) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: N-(2,3,4-trifluorophenyl)acetamide. InChIKey: YHTIZYPWNFRADV-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | N-(2,3,4-trifluorophenyl)acetamide |
| InChIKey | YHTIZYPWNFRADV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)