cas: 344-62-7 — see every product listed under this CAS number, including other names
N-(2-(Trifluoromethyl)phenyl)acetamide 98% (CAS 344-62-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172230-1g |
| cas | 344-62-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 298.06 Pln | |
| Ambeed | 100g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A172230 |
N-[2-(trifluoromethyl)phenyl]acetamide (CAS 344-62-7) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: N-[2-(trifluoromethyl)phenyl]acetamide. InChIKey: OXDTZGRSCDEKGO-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | N-[2-(trifluoromethyl)phenyl]acetamide |
| InChIKey | OXDTZGRSCDEKGO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C(F)(F)F |
Computed by PubChem (NCBI)