cas: 29124-64-9 — see every product listed under this CAS number, including other names
N-(2-Acetyl-4-bromophenyl)acetamide 98% (CAS 29124-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A232528-100mg |
| cas | 29124-64-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A232528 |
N-(2-acetyl-4-bromophenyl)acetamide (CAS 29124-64-9) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: N-(2-acetyl-4-bromophenyl)acetamide. InChIKey: SGHNZIRCTDCQPX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | N-(2-acetyl-4-bromophenyl)acetamide |
| InChIKey | SGHNZIRCTDCQPX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)NC(=O)C |
Computed by PubChem (NCBI)