cas: 438192-02-0 — see every product listed under this CAS number, including other names
N-(2-Nitrophenyl)piperidine-4-carboxylic acid, 97% (CAS 438192-02-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033971-500MG |
| cas | 438192-02-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 778.91 Pln | |
| Fluorochem | 1g | 1127.75 Pln | |
| Fluorochem | 5g | 3246.79 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-nitrophenyl)piperidine-4-carboxylic acid (CAS 438192-02-0) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 1-(2-nitrophenyl)piperidine-4-carboxylic acid. InChIKey: KFUXTZKDCWHNGQ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 1-(2-nitrophenyl)piperidine-4-carboxylic acid |
| InChIKey | KFUXTZKDCWHNGQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)