cas: 946826-47-7 — see every product listed under this CAS number, including other names
N-(3-Amino-2,6-difluorophenyl)acetamide, 95%, 95% (CAS 946826-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIG7-100mg |
| cas | 946826-47-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 726.80 Pln | |
| Chemat | 10g | 1312.40 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 100g | 9347.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(3-amino-2,6-difluorophenyl)acetamide (CAS 946826-47-7) is a chemical compound with the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. IUPAC name: N-(3-amino-2,6-difluorophenyl)acetamide. InChIKey: ZVNQJJLMTSCQSO-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | N-(3-amino-2,6-difluorophenyl)acetamide |
| InChIKey | ZVNQJJLMTSCQSO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1F)N)F |
Computed by PubChem (NCBI)