CAS 1240526-68-4 appears in our catalog under these names: N-(2-Amino-4,5-difluorophenyl)acetamide, 95%, N-(2-Amino-4,5-difluorophenyl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-(2-amino-4,5-difluorophenyl)acetamide (CAS 1240526-68-4) is a chemical compound with the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. IUPAC name: N-(2-amino-4,5-difluorophenyl)acetamide. InChIKey: MEWAQUOPHRJZRM-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | N-(2-amino-4,5-difluorophenyl)acetamide |
| InChIKey | MEWAQUOPHRJZRM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1N)F)F |
Computed by PubChem (NCBI)