CAS 17751-24-5 is the registry number for (2,6-Difluoro-Benzyl)-Urea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,6-difluorophenyl)methylurea (CAS 17751-24-5) is a chemical compound with the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. IUPAC name: (2,6-difluorophenyl)methylurea. InChIKey: XJGQUIHBNMXOQE-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | (2,6-difluorophenyl)methylurea |
| InChIKey | XJGQUIHBNMXOQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CNC(=O)N)F |
Computed by PubChem (NCBI)