CAS 1042434-87-6 is the registry number for 2-Amino-4,5-difluoro-n-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-4,5-difluoro-N-methylbenzamide (CAS 1042434-87-6) is a chemical compound with the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. IUPAC name: 2-amino-4,5-difluoro-N-methylbenzamide. InChIKey: KQTGLOITUZJIRX-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 2-amino-4,5-difluoro-N-methylbenzamide |
| InChIKey | KQTGLOITUZJIRX-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1N)F)F |
Computed by PubChem (NCBI)