CAS 296277-71-9 is the registry number for [(2,4-Difluorophenyl)methyl]urea, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(2,4-difluorophenyl)methylurea (CAS 296277-71-9) is a chemical compound with the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. IUPAC name: (2,4-difluorophenyl)methylurea. InChIKey: UCWDZVXJSJPZKX-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | (2,4-difluorophenyl)methylurea |
| InChIKey | UCWDZVXJSJPZKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CNC(=O)N |
Computed by PubChem (NCBI)