cas: 40410-54-6 — see every product listed under this CAS number, including other names
N-(3-Chlorophenyl)-2,2,2-trifluoroacetamide, 95-<97% (CAS 40410-54-6) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC3062-95-97-2.5g |
| cas | 40410-54-6 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 3957.36 Pln | |
| Hoffman Fine Chemicals | 5g | 6152.08 Pln | |
| Hoffman Fine Chemicals | 10g | 9654.70 Pln | |
| Hoffman Fine Chemicals | 25g | 19001.40 Pln | |
| Hoffman Fine Chemicals | 50g | 32086.78 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
N-(3-chlorophenyl)-2,2,2-trifluoroacetamide (CAS 40410-54-6) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: N-(3-chlorophenyl)-2,2,2-trifluoroacetamide. InChIKey: VRKVCIVKSRGSLU-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | N-(3-chlorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | VRKVCIVKSRGSLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)