N-(4-(Phenylamino)pent-3-en-2-ylidene)aniline hydrochloride, 95%
cas: 19164-93-3 — see every product listed under this CAS number, including other names
N-(4-(Phenylamino)pent-3-en-2-ylidene)aniline hydrochloride, 95% (CAS 19164-93-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1501766-250mg |
| cas | 19164-93-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 948.88 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 231.05 Pln | |
| BLDpharm | 5g | 636.47 Pln | |
| BLDpharm | 10g | 1019.67 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 659.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
N-[(E)-4-phenyliminopent-2-en-2-yl]aniline;hydrochloride (CAS 19164-93-3) is a chemical compound with the molecular formula C17H19ClN2 and a molecular weight of 286.8 g/mol. IUPAC name: N-[(E)-4-phenyliminopent-2-en-2-yl]aniline;hydrochloride. InChIKey: YWZFYPUSOAVVRC-KATKPDCMSA-N.
| Molecular formula | C17H19ClN2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | N-[(E)-4-phenyliminopent-2-en-2-yl]aniline;hydrochloride |
| InChIKey | YWZFYPUSOAVVRC-KATKPDCMSA-N |
| SMILES | C/C(=C\C(=NC1=CC=CC=C1)C)/NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
