cas: 99-21-8 — see every product listed under this CAS number, including other names
N-(4-Amino-5-methoxy-2-methylphenyl)benzamide, 98% (CAS 99-21-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547033-100MG |
| cas | 99-21-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2851.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide (CAS 99-21-8) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: N-(4-amino-5-methoxy-2-methylphenyl)benzamide. InChIKey: VENDXQNWODZJGB-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
| InChIKey | VENDXQNWODZJGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=CC=CC=C2)OC)N |
Computed by PubChem (NCBI)