cas: 19243-95-9 — see every product listed under this CAS number, including other names
N-(4-Hydroxyphenyl)methacrylamide (CAS 19243-95-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113FY9-1g |
| cas | 19243-95-9 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 25g | 640.40 Pln |
| delivery time | 3 weeks |
|---|
N-(4-hydroxyphenyl)-2-methylprop-2-enamide (CAS 19243-95-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-(4-hydroxyphenyl)-2-methylprop-2-enamide. InChIKey: XZSZONUJSGDIFI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-2-methylprop-2-enamide |
| InChIKey | XZSZONUJSGDIFI-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)NC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)