cas: 157701-33-2 — see every product listed under this CAS number, including other names
N-(6-Bromo-2,3-dihydro-1H-inden-5-yl)acetamide, 98%, 98% (CAS 157701-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PMX-100mg |
| cas | 157701-33-2 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(6-bromo-2,3-dihydro-1H-inden-5-yl)acetamide (CAS 157701-33-2) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: N-(6-bromo-2,3-dihydro-1H-inden-5-yl)acetamide. InChIKey: BSZWXNUSLPNWEZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | N-(6-bromo-2,3-dihydro-1H-inden-5-yl)acetamide |
| InChIKey | BSZWXNUSLPNWEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C2CCCC2=C1)Br |
Computed by PubChem (NCBI)