CAS 154913-23-2 appears in our catalog under these names: 1-(4-Bromophenyl)piperidin-4-one, 95%, 1-(4-Bromophenyl)piperidin-4-one 95%, 1-(4-Bromophenyl)piperidin-4-one, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-(4-bromophenyl)piperidin-4-one (CAS 154913-23-2) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 1-(4-bromophenyl)piperidin-4-one. InChIKey: FBZGTFCMSGXCRE-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)piperidin-4-one |
| InChIKey | FBZGTFCMSGXCRE-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)