CAS 1784426-29-4 appears in our catalog under these names: 7-Bromo-4,4-dimethyl-3,4-dihydroisoquinolin-1(2h)-one, 95%, 7-Bromo-4,4-dimethyl-3,4-dihydroisoquinolin-1(2H)-one. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
7-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one (CAS 1784426-29-4) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 7-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one. InChIKey: UGOWZEJIWPQYDK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 7-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one |
| InChIKey | UGOWZEJIWPQYDK-UHFFFAOYSA-N |
| SMILES | CC1(CNC(=O)C2=C1C=CC(=C2)Br)C |
Computed by PubChem (NCBI)