cas: 1357387-28-0 — see every product listed under this CAS number, including other names
N-(Prop-2-yn-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 95+% (CAS 1357387-28-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A660287-100mg |
| cas | 1357387-28-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 2217.12 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A660287 |
N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1357387-28-0) is a chemical compound with the molecular formula C16H20BNO3 and a molecular weight of 285.1 g/mol. IUPAC name: N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BJJVNRNPHMBKSF-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO3 |
|---|---|
| Molecular weight | 285.1 g/mol |
| IUPAC name | N-prop-2-ynyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BJJVNRNPHMBKSF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCC#C |
Computed by PubChem (NCBI)