cas: 200192-49-0 — see every product listed under this CAS number, including other names
N-(Triphenylmethyl)-D-asparagine, 98%, 98% (CAS 200192-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CL1-100g |
| cas | 200192-49-0 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1994.00 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 50g | 1302.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-4-amino-4-oxo-2-(tritylamino)butanoic acid (CAS 200192-49-0) is a chemical compound with the molecular formula C23H22N2O3 and a molecular weight of 374.4 g/mol. IUPAC name: (2R)-4-amino-4-oxo-2-(tritylamino)butanoic acid. InChIKey: QIRPOVMESMPVKL-HXUWFJFHSA-N.
| Molecular formula | C23H22N2O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (2R)-4-amino-4-oxo-2-(tritylamino)butanoic acid |
| InChIKey | QIRPOVMESMPVKL-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N[C@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)