CAS 30566-92-8 appears in our catalog under these names: Labetalol Impurity 1, Labetalol Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(dibenzylamino)acetyl]-2-hydroxybenzamide (CAS 30566-92-8) is a chemical compound with the molecular formula C23H22N2O3 and a molecular weight of 374.4 g/mol. IUPAC name: 5-[2-(dibenzylamino)acetyl]-2-hydroxybenzamide. InChIKey: DNLPQXRWAKCKPX-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 5-[2-(dibenzylamino)acetyl]-2-hydroxybenzamide |
| InChIKey | DNLPQXRWAKCKPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)CC(=O)C3=CC(=C(C=C3)O)C(=O)N |
Computed by PubChem (NCBI)