CAS 86925-99-7 appears in our catalog under these names: Z-Pro-betaNA, Z–Pro–βNA, Z-Pro-bNA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 50g.
Benzyl (2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidine-1-carboxylate (CAS 86925-99-7) is a chemical compound with the molecular formula C23H22N2O3 and a molecular weight of 374.4 g/mol. IUPAC name: benzyl (2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidine-1-carboxylate. InChIKey: JNQYOPCQZVPOCL-NRFANRHFSA-N.
| Molecular formula | C23H22N2O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | benzyl (2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidine-1-carboxylate |
| InChIKey | JNQYOPCQZVPOCL-NRFANRHFSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)NC3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)