Products 1005178-02-8
CAS 1005178-02-8 appears in our catalog under these names: TI17, TI17, 97.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 25 mg, 5 mg, 1 mg.
7-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid (CAS 1005178-02-8) is a chemical compound with the molecular formula C23H22N2O3 and a molecular weight of 374.4 g/mol. IUPAC name: 7-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid. InChIKey: FTGODPNMSWLLKK-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 7-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]tricyclo[3.2.2.02,4]non-8-ene-6-carboxylic acid |
| InChIKey | FTGODPNMSWLLKK-UHFFFAOYSA-N |
| SMILES | C1C2C1C3C=CC2C(C3C(=O)O)C(=O)NC4=CC=C(C=C4)CC5=CC=NC=C5 |
Computed by PubChem (NCBI)
Synonyms:
orb2565163, orb3032985