CAS 132388-58-0 appears in our catalog under these names: H–Asn(Trt)–OH, Ngamma-Trityl-L-asparagine hydrate, 98% , (2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 25g, 5g, 1g.
(2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid (CAS 132388-58-0) is a chemical compound with the molecular formula C23H22N2O3 and a molecular weight of 374.4 g/mol. IUPAC name: (2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid. InChIKey: BRRPJQYCERAMFI-FQEVSTJZSA-N.
| Molecular formula | C23H22N2O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid |
| InChIKey | BRRPJQYCERAMFI-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)