cas: 186023-44-9 — see every product listed under this CAS number, including other names
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-proline, 98% (CAS 186023-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VQNH-100mg |
| cas | 186023-44-9 |
| size | 100mg |
| availability | 991g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 50g | 1096.40 Pln | |
| Chemat | 100g | 1682.00 Pln | |
| Chemat | 250g | 3165.20 Pln | |
| Chemat | 500g | 4958.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid (CAS 186023-44-9) is a chemical compound with the molecular formula C23H24N2O5 and a molecular weight of 408.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: HLFCRSYTJCARCY-XOBRGWDASA-N.
| Molecular formula | C23H24N2O5 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | HLFCRSYTJCARCY-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)