Products 1037834-34-6
CAS 1037834-34-6 is the registry number for Methyl 1-(1-((benzyloxy)carbonyl)piperidin-4-yl)-2-oxoindoline-5-carboxylate. Offered by: Biosynth. Available pack sizes: 5000mg.
Methyl 2-oxo-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-3H-indole-5-carboxylate (CAS 1037834-34-6) is a chemical compound with the molecular formula C23H24N2O5 and a molecular weight of 408.4 g/mol. IUPAC name: methyl 2-oxo-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-3H-indole-5-carboxylate. InChIKey: GEMLWNDJKFMFEA-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O5 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | methyl 2-oxo-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-3H-indole-5-carboxylate |
| InChIKey | GEMLWNDJKFMFEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N(C(=O)C2)C3CCN(CC3)C(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)