cas: 644-33-7 — see every product listed under this CAS number, including other names
N-[2-(Phenylformamido)ethyl]benzamide, 95% (CAS 644-33-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F181946-100MG |
| cas | 644-33-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 25g | 1486.99 Pln | |
| Fluorochem | 100g | 4704.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-benzamidoethyl)benzamide (CAS 644-33-7) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: N-(2-benzamidoethyl)benzamide. InChIKey: NWGGAHDZCNJXJA-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | N-(2-benzamidoethyl)benzamide |
| InChIKey | NWGGAHDZCNJXJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)