cas: 168982-69-2 — see every product listed under this CAS number, including other names
N-3-oxo-dodecanoyl-L-homoserine lactone 95% (CAS 168982-69-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A683078-5mg |
| cas | 168982-69-2 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 192.38 Pln | |
| Ambeed | 10mg | 259.12 Pln | |
| Ambeed | 25mg | 537.25 Pln | |
| Ambeed | 50mg | 915.50 Pln | |
| Ambeed | 100mg | 1571.88 Pln | |
| Ambeed | 250mg | 3162.75 Pln | |
| Ambeed | 1g | 9982.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A683078 |
N-(3-oxododecanoyl)-L-homoserine lactone is an N-acyl-L-homoserine lactone having 3-oxododecanoyl as the acyl substituent. It has a role as a bacterial metabolite. It is a N-(3-oxododecanoyl)homoserine lactone and a N-acyl-L-homoserine lactone. It is an enantiomer of a N-(3-oxododecanoyl)-D-homoserine lactone.
Source: ChEBI
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]dodecanamide |
| InChIKey | PHSRRHGYXQCRPU-AWEZNQCLSA-N |
| SMILES | CCCCCCCCCC(=O)CC(=O)N[C@H]1CCOC1=O |
Computed by PubChem (NCBI)