cas: 28044-77-1 — see every product listed under this CAS number, including other names
N-BOC-2-(P-TOLYL)-DL-GLYCINE, 97% (CAS 28044-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F466642-1G |
| cas | 28044-77-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3376.95 Pln | |
| Fluorochem | 10g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 28044-77-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: SNDBWQDZODFRCK-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | SNDBWQDZODFRCK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)