cas: 1210278-19-5 — see every product listed under this CAS number, including other names
N-Boc-2-Amino-4-cyanothiazole, 97%, 97% (CAS 1210278-19-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11850V-100mg |
| cas | 1210278-19-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 410.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-cyano-1,3-thiazol-2-yl)carbamate (CAS 1210278-19-5) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: tert-butyl N-(4-cyano-1,3-thiazol-2-yl)carbamate. InChIKey: NCIFXFYMOYDWHW-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | tert-butyl N-(4-cyano-1,3-thiazol-2-yl)carbamate |
| InChIKey | NCIFXFYMOYDWHW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CS1)C#N |
Computed by PubChem (NCBI)