CAS 123036-51-1 appears in our catalog under these names: N–Boc–3–aminophenylacetic Acid, Boc-3-APAc-OH, N-Boc-3-aminophenylacetic Acid, 98%, 98%, 3-tert-Butoxycarbonylaminophenyl acetic acid, 98%, Benzeneacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g, 10g.
2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid (CAS 123036-51-1) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid. InChIKey: RGLDALVJLSFYMV-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid |
| InChIKey | RGLDALVJLSFYMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)CC(=O)O |
Computed by PubChem (NCBI)