cas: 64727-35-1 — see every product listed under this CAS number, including other names
N-Boc-DL-Leucine, 98%, 98% (CAS 64727-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9NH-100mg |
| cas | 64727-35-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 530.00 Pln | |
| Chemat | 25g | 914.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 64727-35-1) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: MDXGYYOJGPFFJL-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | MDXGYYOJGPFFJL-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)