cas: 79069-13-9 — see every product listed under this CAS number, including other names
N-Boc-L-alaninol, 98%, 98% (CAS 79069-13-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 50g, 100g, 250g, 500g, 1000g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143GN-1g |
| cas | 79069-13-9 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 250g | 237.20 Pln | |
| Chemat | 500g | 422.40 Pln | |
| Chemat | 1000g | 731.60 Pln | |
| Chemat | 5kg | 3048.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-1-hydroxypropan-2-yl]carbamate (CAS 79069-13-9) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxypropan-2-yl]carbamate. InChIKey: PDAFIZPRSXHMCO-LURJTMIESA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxypropan-2-yl]carbamate |
| InChIKey | PDAFIZPRSXHMCO-LURJTMIESA-N |
| SMILES | C[C@@H](CO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)