CAS 106391-86-0 appears in our catalog under these names: N-Boc-D-alaninol, Boc–D–Alaninol, Boc-D-Ala-ol, N-Boc-D-alaninol, 98%, ee 98% , Boc-D-alaninol. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 2,5g, 250mg, 500mg, 1g, 5g, 25g, 0,25kg, 10g.
Tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate (CAS 106391-86-0) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate. InChIKey: PDAFIZPRSXHMCO-ZCFIWIBFSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate |
| InChIKey | PDAFIZPRSXHMCO-ZCFIWIBFSA-N |
| SMILES | C[C@H](CO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)