cas: 177785-41-0 — see every product listed under this CAS number, including other names
N-Cyclopropyl 4-Aminophenylsulfonamide 95% (CAS 177785-41-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294793-100mg |
| cas | 177785-41-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 10g | 1822.19 Pln | |
| Ambeed | 25g | 3134.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A294793 |
4-amino-N-cyclopropylbenzenesulfonamide (CAS 177785-41-0) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 4-amino-N-cyclopropylbenzenesulfonamide. InChIKey: KOLXPLAKQKRJLH-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-amino-N-cyclopropylbenzenesulfonamide |
| InChIKey | KOLXPLAKQKRJLH-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)