cas: 380605-28-7 — see every product listed under this CAS number, including other names
N-Cyclopropyl-3-nitropyridin-4-amine, 98%, 98% (CAS 380605-28-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187FI-1g |
| cas | 380605-28-7 |
| size | 1g |
| availability | 85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2234.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-3-nitropyridin-4-amine (CAS 380605-28-7) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: N-cyclopropyl-3-nitropyridin-4-amine. InChIKey: OXWIUZUWZJVMSR-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | N-cyclopropyl-3-nitropyridin-4-amine |
| InChIKey | OXWIUZUWZJVMSR-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=NC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)