cas: 887351-37-3 — see every product listed under this CAS number, including other names
N-Cyclopropyl-4-fluoro-2-nitroaniline 99% (CAS 887351-37-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A908257-5g |
| cas | 887351-37-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 698.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A908257 |
N-cyclopropyl-4-fluoro-2-nitroaniline (CAS 887351-37-3) is a chemical compound with the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. IUPAC name: N-cyclopropyl-4-fluoro-2-nitroaniline. InChIKey: IFVGZPQVABAJNL-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O2 |
|---|---|
| Molecular weight | 196.18 g/mol |
| IUPAC name | N-cyclopropyl-4-fluoro-2-nitroaniline |
| InChIKey | IFVGZPQVABAJNL-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)