CAS 912878-83-2 is the registry number for 7-Fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline (CAS 912878-83-2) is a chemical compound with the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. IUPAC name: 7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline. InChIKey: HEKBRXZMLYKQRP-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O2 |
|---|---|
| Molecular weight | 196.18 g/mol |
| IUPAC name | 7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | HEKBRXZMLYKQRP-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)[N+](=O)[O-])F |
Computed by PubChem (NCBI)