CAS 887351-37-3 appears in our catalog under these names: N-Cyclopropyl-4-fluoro-2-nitroaniline, 99%, N–Cyclopropyl–4–fluoro–2–nitroaniline, N-Cyclopropyl-4-fluoro-2-nitroaniline 99%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 25g, 100g, 500g, 5g, 1g.
N-cyclopropyl-4-fluoro-2-nitroaniline (CAS 887351-37-3) is a chemical compound with the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. IUPAC name: N-cyclopropyl-4-fluoro-2-nitroaniline. InChIKey: IFVGZPQVABAJNL-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O2 |
|---|---|
| Molecular weight | 196.18 g/mol |
| IUPAC name | N-cyclopropyl-4-fluoro-2-nitroaniline |
| InChIKey | IFVGZPQVABAJNL-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)